About 2-[(4-bromo-1,3-thiazol-2-yl)-(2,2-difluoroethyl)amino]ethanol
2-[(4-bromo-1,3-thiazol-2-yl)-(2,2-difluoroethyl)amino]ethanol (PubChem CID 107482095) has the molecular formula C7H9BrF2N2OS
and a molecular weight of 287.13 g/mol. Its IUPAC name is 2-[(4-bromo-1,3-thiazol-2-yl)-(2,2-difluoroethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(4-bromo-1,3-thiazol-2-yl)-(2,2-difluoroethyl)amino]ethanol |
| PubChem CID | 107482095 |
| Molecular Formula | C7H9BrF2N2OS |
| Molecular Weight | 287.13 g/mol |
| Exact Mass | 285.96 |
| IUPAC Name | 2-[(4-bromo-1,3-thiazol-2-yl)-(2,2-difluoroethyl)amino]ethanol |
| SMILES | OCCN(CC(F)F)c1nc(Br)cs1 |
| InChI | InChI=1S/C7H9BrF2N2OS/c8-5-4-14-7(11-5)12(1-2-13)3-6(9)10/h4,6,13H,1-3H2 |
| InChIKey | SJLFSSCCPKGIPY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.13 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-bromo-1,3-thiazol-2-yl)-(2,2-difluoroethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-bromo-1,3-thiazol-2-yl)-(2,2-difluoroethyl)amino]ethanol?
The IUPAC name of 2-[(4-bromo-1,3-thiazol-2-yl)-(2,2-difluoroethyl)amino]ethanol (CID 107482095) is 2-[(4-bromo-1,3-thiazol-2-yl)-(2,2-difluoroethyl)amino]ethanol.
What is the SMILES notation for 2-[(4-bromo-1,3-thiazol-2-yl)-(2,2-difluoroethyl)amino]ethanol?
The canonical SMILES for 2-[(4-bromo-1,3-thiazol-2-yl)-(2,2-difluoroethyl)amino]ethanol is OCCN(CC(F)F)c1nc(Br)cs1.
What is the InChIKey of 2-[(4-bromo-1,3-thiazol-2-yl)-(2,2-difluoroethyl)amino]ethanol?
The InChIKey is SJLFSSCCPKGIPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrF2N2OS/c8-5-4-14-7(11-5)12(1-2-13)3-6(9)10/h4,6,13H,1-3H2.
What are the key properties of 2-[(4-bromo-1,3-thiazol-2-yl)-(2,2-difluoroethyl)amino]ethanol?
2-[(4-bromo-1,3-thiazol-2-yl)-(2,2-difluoroethyl)amino]ethanol has a molecular weight of 287.13 g/mol, XLogP of 1.97, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-bromo-1,3-thiazol-2-yl)-(2,2-difluoroethyl)amino]ethanol is sourced from PubChem (CID 107482095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).