C9H16F3N3O3 — CID 107482239
3-amino-N-(2-hydroxyethyl)-3-hydroxyimino-2,2-dimethyl-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 107482239) has the molecular formula C9H16F3N3O3 and a molecular weight of 271.24 g/mol. Its IUPAC name is 3-amino-N-(2-hydroxyethyl)-3-hydroxyimino-2,2-dimethyl-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 3-amino-N-(2-hydroxyethyl)-3-hydroxyimino-2,2-dimethyl-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 107482239 |
| Molecular Formula | C9H16F3N3O3 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 3-amino-N-(2-hydroxyethyl)-3-hydroxyimino-2,2-dimethyl-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(C)(C(=O)N(CCO)CC(F)(F)F)C(N)=NO |
| InChI | InChI=1S/C9H16F3N3O3/c1-8(2,6(13)14-18)7(17)15(3-4-16)5-9(10,11)12/h16,18H,3-5H2,1-2H3,(H2,13,14) |
| InChIKey | IMRSXWSHSDDBDH-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|