About 2-cycloheptyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide
2-cycloheptyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide (PubChem CID 107482346) has the molecular formula C13H23F2NO2
and a molecular weight of 263.33 g/mol. Its IUPAC name is 2-cycloheptyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-cycloheptyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide |
| PubChem CID | 107482346 |
| Molecular Formula | C13H23F2NO2 |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 2-cycloheptyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide |
| SMILES | O=C(CC1CCCCCC1)N(CCO)CC(F)F |
| InChI | InChI=1S/C13H23F2NO2/c14-12(15)10-16(7-8-17)13(18)9-11-5-3-1-2-4-6-11/h11-12,17H,1-10H2 |
| InChIKey | SZULXMAKHQWBNP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cycloheptyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cycloheptyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide?
The IUPAC name of 2-cycloheptyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide (CID 107482346) is 2-cycloheptyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide.
What is the SMILES notation for 2-cycloheptyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide?
The canonical SMILES for 2-cycloheptyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide is O=C(CC1CCCCCC1)N(CCO)CC(F)F.
What is the InChIKey of 2-cycloheptyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide?
The InChIKey is SZULXMAKHQWBNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23F2NO2/c14-12(15)10-16(7-8-17)13(18)9-11-5-3-1-2-4-6-11/h11-12,17H,1-10H2.
What are the key properties of 2-cycloheptyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide?
2-cycloheptyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide has a molecular weight of 263.33 g/mol, XLogP of 2.43, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cycloheptyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide is sourced from PubChem (CID 107482346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).