C10H14F2N2O5S2 — CID 107483497
3-N-(2,2-difluoroethyl)-3-N-(2-hydroxyethyl)benzene-1,3-disulfonamide (PubChem CID 107483497) has the molecular formula C10H14F2N2O5S2 and a molecular weight of 344.36 g/mol. Its IUPAC name is 3-N-(2,2-difluoroethyl)-3-N-(2-hydroxyethyl)benzene-1,3-disulfonamide.
| Compound Name | 3-N-(2,2-difluoroethyl)-3-N-(2-hydroxyethyl)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 107483497 |
| Molecular Formula | C10H14F2N2O5S2 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 3-N-(2,2-difluoroethyl)-3-N-(2-hydroxyethyl)benzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)N(CCO)CC(F)F)c1 |
| InChI | InChI=1S/C10H14F2N2O5S2/c11-10(12)7-14(4-5-15)21(18,19)9-3-1-2-8(6-9)20(13,16)17/h1-3,6,10,15H,4-5,7H2,(H2,13,16,17) |
| InChIKey | XAJOHMPJTPVQOX-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |