C7H13F2NO3S — CID 107483514
N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)prop-2-ene-1-sulfonamide (PubChem CID 107483514) has the molecular formula C7H13F2NO3S and a molecular weight of 229.25 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)prop-2-ene-1-sulfonamide.
| Compound Name | N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)prop-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 107483514 |
| Molecular Formula | C7H13F2NO3S |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)prop-2-ene-1-sulfonamide |
| SMILES | C=CCS(=O)(=O)N(CCO)CC(F)F |
| InChI | InChI=1S/C7H13F2NO3S/c1-2-5-14(12,13)10(3-4-11)6-7(8)9/h2,7,11H,1,3-6H2 |
| InChIKey | SGRRSKFQBYTKLK-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|