About 2,5-dibromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-methylbenzenesulfonamide
2,5-dibromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-methylbenzenesulfonamide (PubChem CID 107483532) has the molecular formula C11H13Br2F2NO3S
and a molecular weight of 437.10 g/mol. Its IUPAC name is 2,5-dibromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2,5-dibromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-methylbenzenesulfonamide |
| PubChem CID | 107483532 |
| Molecular Formula | C11H13Br2F2NO3S |
| Molecular Weight | 437.10 g/mol |
| Exact Mass | 434.90 |
| IUPAC Name | 2,5-dibromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)N(CCO)CC(F)F)cc1Br |
| InChI | InChI=1S/C11H13Br2F2NO3S/c1-7-4-9(13)10(5-8(7)12)20(18,19)16(2-3-17)6-11(14)15/h4-5,11,17H,2-3,6H2,1H3 |
| InChIKey | FVUDYCJAGMOEIV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.10 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dibromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dibromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-methylbenzenesulfonamide?
The IUPAC name of 2,5-dibromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-methylbenzenesulfonamide (CID 107483532) is 2,5-dibromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-methylbenzenesulfonamide.
What is the SMILES notation for 2,5-dibromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-methylbenzenesulfonamide?
The canonical SMILES for 2,5-dibromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-methylbenzenesulfonamide is Cc1cc(Br)c(S(=O)(=O)N(CCO)CC(F)F)cc1Br.
What is the InChIKey of 2,5-dibromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-methylbenzenesulfonamide?
The InChIKey is FVUDYCJAGMOEIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Br2F2NO3S/c1-7-4-9(13)10(5-8(7)12)20(18,19)16(2-3-17)6-11(14)15/h4-5,11,17H,2-3,6H2,1H3.
What are the key properties of 2,5-dibromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-methylbenzenesulfonamide?
2,5-dibromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-methylbenzenesulfonamide has a molecular weight of 437.10 g/mol, XLogP of 2.77, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dibromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-methylbenzenesulfonamide is sourced from PubChem (CID 107483532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).