About ethyl 3-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]propanoate
ethyl 3-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]propanoate (PubChem CID 107483738) has the molecular formula C9H16F3NO5S
and a molecular weight of 307.29 g/mol. Its IUPAC name is ethyl 3-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]propanoate |
| PubChem CID | 107483738 |
| Molecular Formula | C9H16F3NO5S |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | ethyl 3-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]propanoate |
| SMILES | CCOC(=O)CCS(=O)(=O)N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C9H16F3NO5S/c1-2-18-8(15)3-6-19(16,17)13(4-5-14)7-9(10,11)12/h14H,2-7H2,1H3 |
| InChIKey | IJSNDUDLJAYIDI-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]propanoate?
The IUPAC name of ethyl 3-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]propanoate (CID 107483738) is ethyl 3-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]propanoate.
What is the SMILES notation for ethyl 3-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]propanoate?
The canonical SMILES for ethyl 3-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]propanoate is CCOC(=O)CCS(=O)(=O)N(CCO)CC(F)(F)F.
What is the InChIKey of ethyl 3-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]propanoate?
The InChIKey is IJSNDUDLJAYIDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO5S/c1-2-18-8(15)3-6-19(16,17)13(4-5-14)7-9(10,11)12/h14H,2-7H2,1H3.
What are the key properties of ethyl 3-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]propanoate?
ethyl 3-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]propanoate has a molecular weight of 307.29 g/mol, XLogP of 0.13, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2-hydroxyethyl(2,2,2-trifluoroethyl)sulfamoyl]propanoate is sourced from PubChem (CID 107483738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).