About 1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopentan-1-ol
1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopentan-1-ol (PubChem CID 107483842) has the molecular formula C10H19F2NO2
and a molecular weight of 223.26 g/mol. Its IUPAC name is 1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | 1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopentan-1-ol |
| PubChem CID | 107483842 |
| Molecular Formula | C10H19F2NO2 |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopentan-1-ol |
| SMILES | OCCN(CC(F)F)CC1(O)CCCC1 |
| InChI | InChI=1S/C10H19F2NO2/c11-9(12)7-13(5-6-14)8-10(15)3-1-2-4-10/h9,14-15H,1-8H2 |
| InChIKey | QJLYNVGGIRGVAX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopentan-1-ol?
The IUPAC name of 1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopentan-1-ol (CID 107483842) is 1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopentan-1-ol.
What is the SMILES notation for 1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopentan-1-ol?
The canonical SMILES for 1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopentan-1-ol is OCCN(CC(F)F)CC1(O)CCCC1.
What is the InChIKey of 1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopentan-1-ol?
The InChIKey is QJLYNVGGIRGVAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F2NO2/c11-9(12)7-13(5-6-14)8-10(15)3-1-2-4-10/h9,14-15H,1-8H2.
What are the key properties of 1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopentan-1-ol?
1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopentan-1-ol has a molecular weight of 223.26 g/mol, XLogP of 0.85, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopentan-1-ol is sourced from PubChem (CID 107483842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).