About 3-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)propane-1-sulfonamide
3-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)propane-1-sulfonamide (PubChem CID 107483903) has the molecular formula C7H14ClF2NO3S
and a molecular weight of 265.71 g/mol. Its IUPAC name is 3-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)propane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)propane-1-sulfonamide |
| PubChem CID | 107483903 |
| Molecular Formula | C7H14ClF2NO3S |
| Molecular Weight | 265.71 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 3-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCl)N(CCO)CC(F)F |
| InChI | InChI=1S/C7H14ClF2NO3S/c8-2-1-5-15(13,14)11(3-4-12)6-7(9)10/h7,12H,1-6H2 |
| InChIKey | WKLPJTLOICZPDE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.71 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)propane-1-sulfonamide?
The IUPAC name of 3-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)propane-1-sulfonamide (CID 107483903) is 3-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)propane-1-sulfonamide.
What is the SMILES notation for 3-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)propane-1-sulfonamide?
The canonical SMILES for 3-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)propane-1-sulfonamide is O=S(=O)(CCCCl)N(CCO)CC(F)F.
What is the InChIKey of 3-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)propane-1-sulfonamide?
The InChIKey is WKLPJTLOICZPDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14ClF2NO3S/c8-2-1-5-15(13,14)11(3-4-12)6-7(9)10/h7,12H,1-6H2.
What are the key properties of 3-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)propane-1-sulfonamide?
3-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)propane-1-sulfonamide has a molecular weight of 265.71 g/mol, XLogP of 0.50, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)propane-1-sulfonamide is sourced from PubChem (CID 107483903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).