About 2-[2,2-difluoroethyl-(4,6-dimethoxypyrimidin-2-yl)amino]ethanol
2-[2,2-difluoroethyl-(4,6-dimethoxypyrimidin-2-yl)amino]ethanol (PubChem CID 107484057) has the molecular formula C10H15F2N3O3
and a molecular weight of 263.24 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-(4,6-dimethoxypyrimidin-2-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[2,2-difluoroethyl-(4,6-dimethoxypyrimidin-2-yl)amino]ethanol |
| PubChem CID | 107484057 |
| Molecular Formula | C10H15F2N3O3 |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-[2,2-difluoroethyl-(4,6-dimethoxypyrimidin-2-yl)amino]ethanol |
| SMILES | COc1cc(OC)nc(N(CCO)CC(F)F)n1 |
| InChI | InChI=1S/C10H15F2N3O3/c1-17-8-5-9(18-2)14-10(13-8)15(3-4-16)6-7(11)12/h5,7,16H,3-4,6H2,1-2H3 |
| InChIKey | JEXRNLKUYPBSID-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2,2-difluoroethyl-(4,6-dimethoxypyrimidin-2-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-difluoroethyl-(4,6-dimethoxypyrimidin-2-yl)amino]ethanol?
The IUPAC name of 2-[2,2-difluoroethyl-(4,6-dimethoxypyrimidin-2-yl)amino]ethanol (CID 107484057) is 2-[2,2-difluoroethyl-(4,6-dimethoxypyrimidin-2-yl)amino]ethanol.
What is the SMILES notation for 2-[2,2-difluoroethyl-(4,6-dimethoxypyrimidin-2-yl)amino]ethanol?
The canonical SMILES for 2-[2,2-difluoroethyl-(4,6-dimethoxypyrimidin-2-yl)amino]ethanol is COc1cc(OC)nc(N(CCO)CC(F)F)n1.
What is the InChIKey of 2-[2,2-difluoroethyl-(4,6-dimethoxypyrimidin-2-yl)amino]ethanol?
The InChIKey is JEXRNLKUYPBSID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F2N3O3/c1-17-8-5-9(18-2)14-10(13-8)15(3-4-16)6-7(11)12/h5,7,16H,3-4,6H2,1-2H3.
What are the key properties of 2-[2,2-difluoroethyl-(4,6-dimethoxypyrimidin-2-yl)amino]ethanol?
2-[2,2-difluoroethyl-(4,6-dimethoxypyrimidin-2-yl)amino]ethanol has a molecular weight of 263.24 g/mol, XLogP of 0.56, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-difluoroethyl-(4,6-dimethoxypyrimidin-2-yl)amino]ethanol is sourced from PubChem (CID 107484057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).