About 2-[2,2-difluoroethyl-(5-methylpyridazin-3-yl)amino]ethanol
2-[2,2-difluoroethyl-(5-methylpyridazin-3-yl)amino]ethanol (PubChem CID 107484128) has the molecular formula C9H13F2N3O
and a molecular weight of 217.22 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-(5-methylpyridazin-3-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[2,2-difluoroethyl-(5-methylpyridazin-3-yl)amino]ethanol |
| PubChem CID | 107484128 |
| Molecular Formula | C9H13F2N3O |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 2-[2,2-difluoroethyl-(5-methylpyridazin-3-yl)amino]ethanol |
| SMILES | Cc1cnnc(N(CCO)CC(F)F)c1 |
| InChI | InChI=1S/C9H13F2N3O/c1-7-4-9(13-12-5-7)14(2-3-15)6-8(10)11/h4-5,8,15H,2-3,6H2,1H3 |
| InChIKey | IZCCSIFXQDVWFC-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2,2-difluoroethyl-(5-methylpyridazin-3-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-difluoroethyl-(5-methylpyridazin-3-yl)amino]ethanol?
The IUPAC name of 2-[2,2-difluoroethyl-(5-methylpyridazin-3-yl)amino]ethanol (CID 107484128) is 2-[2,2-difluoroethyl-(5-methylpyridazin-3-yl)amino]ethanol.
What is the SMILES notation for 2-[2,2-difluoroethyl-(5-methylpyridazin-3-yl)amino]ethanol?
The canonical SMILES for 2-[2,2-difluoroethyl-(5-methylpyridazin-3-yl)amino]ethanol is Cc1cnnc(N(CCO)CC(F)F)c1.
What is the InChIKey of 2-[2,2-difluoroethyl-(5-methylpyridazin-3-yl)amino]ethanol?
The InChIKey is IZCCSIFXQDVWFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2N3O/c1-7-4-9(13-12-5-7)14(2-3-15)6-8(10)11/h4-5,8,15H,2-3,6H2,1H3.
What are the key properties of 2-[2,2-difluoroethyl-(5-methylpyridazin-3-yl)amino]ethanol?
2-[2,2-difluoroethyl-(5-methylpyridazin-3-yl)amino]ethanol has a molecular weight of 217.22 g/mol, XLogP of 0.85, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-difluoroethyl-(5-methylpyridazin-3-yl)amino]ethanol is sourced from PubChem (CID 107484128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).