About 2-[2,2-difluoroethyl-(1-methyl-4-nitro-3-propylpyrazol-5-yl)amino]ethanol
2-[2,2-difluoroethyl-(1-methyl-4-nitro-3-propylpyrazol-5-yl)amino]ethanol (PubChem CID 107484158) has the molecular formula C11H18F2N4O3
and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-(1-methyl-4-nitro-3-propylpyrazol-5-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[2,2-difluoroethyl-(1-methyl-4-nitro-3-propylpyrazol-5-yl)amino]ethanol |
| PubChem CID | 107484158 |
| Molecular Formula | C11H18F2N4O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-[2,2-difluoroethyl-(1-methyl-4-nitro-3-propylpyrazol-5-yl)amino]ethanol |
| SMILES | CCCc1nn(C)c(N(CCO)CC(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H18F2N4O3/c1-3-4-8-10(17(19)20)11(15(2)14-8)16(5-6-18)7-9(12)13/h9,18H,3-7H2,1-2H3 |
| InChIKey | KUVGCQFDEVNHMG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-difluoroethyl-(1-methyl-4-nitro-3-propylpyrazol-5-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-difluoroethyl-(1-methyl-4-nitro-3-propylpyrazol-5-yl)amino]ethanol?
The IUPAC name of 2-[2,2-difluoroethyl-(1-methyl-4-nitro-3-propylpyrazol-5-yl)amino]ethanol (CID 107484158) is 2-[2,2-difluoroethyl-(1-methyl-4-nitro-3-propylpyrazol-5-yl)amino]ethanol.
What is the SMILES notation for 2-[2,2-difluoroethyl-(1-methyl-4-nitro-3-propylpyrazol-5-yl)amino]ethanol?
The canonical SMILES for 2-[2,2-difluoroethyl-(1-methyl-4-nitro-3-propylpyrazol-5-yl)amino]ethanol is CCCc1nn(C)c(N(CCO)CC(F)F)c1[N+](=O)[O-].
What is the InChIKey of 2-[2,2-difluoroethyl-(1-methyl-4-nitro-3-propylpyrazol-5-yl)amino]ethanol?
The InChIKey is KUVGCQFDEVNHMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F2N4O3/c1-3-4-8-10(17(19)20)11(15(2)14-8)16(5-6-18)7-9(12)13/h9,18H,3-7H2,1-2H3.
What are the key properties of 2-[2,2-difluoroethyl-(1-methyl-4-nitro-3-propylpyrazol-5-yl)amino]ethanol?
2-[2,2-difluoroethyl-(1-methyl-4-nitro-3-propylpyrazol-5-yl)amino]ethanol has a molecular weight of 292.29 g/mol, XLogP of 1.34, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-difluoroethyl-(1-methyl-4-nitro-3-propylpyrazol-5-yl)amino]ethanol is sourced from PubChem (CID 107484158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).