C11H22F2N2O — CID 107484683
2-[(2-aminocycloheptyl)-(2,2-difluoroethyl)amino]ethanol (PubChem CID 107484683) has the molecular formula C11H22F2N2O and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-[(2-aminocycloheptyl)-(2,2-difluoroethyl)amino]ethanol.
| Compound Name | 2-[(2-aminocycloheptyl)-(2,2-difluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107484683 |
| Molecular Formula | C11H22F2N2O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 2-[(2-aminocycloheptyl)-(2,2-difluoroethyl)amino]ethanol |
| SMILES | NC1CCCCCC1N(CCO)CC(F)F |
| InChI | InChI=1S/C11H22F2N2O/c12-11(13)8-15(6-7-16)10-5-3-1-2-4-9(10)14/h9-11,16H,1-8,14H2 |
| InChIKey | PABURBQPCGBJNQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |