About 2-[3-azidopropyl(2,2-difluoroethyl)amino]ethanol
2-[3-azidopropyl(2,2-difluoroethyl)amino]ethanol (PubChem CID 107484810) has the molecular formula C7H14F2N4O
and a molecular weight of 208.21 g/mol. Its IUPAC name is 2-[3-azidopropyl(2,2-difluoroethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[3-azidopropyl(2,2-difluoroethyl)amino]ethanol |
| PubChem CID | 107484810 |
| Molecular Formula | C7H14F2N4O |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2-[3-azidopropyl(2,2-difluoroethyl)amino]ethanol |
| SMILES | [N-]=[N+]=NCCCN(CCO)CC(F)F |
| InChI | InChI=1S/C7H14F2N4O/c8-7(9)6-13(4-5-14)3-1-2-11-12-10/h7,14H,1-6H2 |
| InChIKey | YWMIGFXLUGPPFF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 72.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-azidopropyl(2,2-difluoroethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-azidopropyl(2,2-difluoroethyl)amino]ethanol?
The IUPAC name of 2-[3-azidopropyl(2,2-difluoroethyl)amino]ethanol (CID 107484810) is 2-[3-azidopropyl(2,2-difluoroethyl)amino]ethanol.
What is the SMILES notation for 2-[3-azidopropyl(2,2-difluoroethyl)amino]ethanol?
The canonical SMILES for 2-[3-azidopropyl(2,2-difluoroethyl)amino]ethanol is [N-]=[N+]=NCCCN(CCO)CC(F)F.
What is the InChIKey of 2-[3-azidopropyl(2,2-difluoroethyl)amino]ethanol?
The InChIKey is YWMIGFXLUGPPFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F2N4O/c8-7(9)6-13(4-5-14)3-1-2-11-12-10/h7,14H,1-6H2.
What are the key properties of 2-[3-azidopropyl(2,2-difluoroethyl)amino]ethanol?
2-[3-azidopropyl(2,2-difluoroethyl)amino]ethanol has a molecular weight of 208.21 g/mol, XLogP of 1.25, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-azidopropyl(2,2-difluoroethyl)amino]ethanol is sourced from PubChem (CID 107484810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).