About 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-9-methylpyrido[1,2-a]pyrimidin-4-one
2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-9-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 107485031) has the molecular formula C14H17F2N3O2
and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-9-methylpyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-9-methylpyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 107485031 |
| Molecular Formula | C14H17F2N3O2 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-9-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cccn2c(=O)cc(CN(CCO)CC(F)F)nc12 |
| InChI | InChI=1S/C14H17F2N3O2/c1-10-3-2-4-19-13(21)7-11(17-14(10)19)8-18(5-6-20)9-12(15)16/h2-4,7,12,20H,5-6,8-9H2,1H3 |
| InChIKey | VHNZGSJDALGRNE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-9-methylpyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-9-methylpyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-9-methylpyrido[1,2-a]pyrimidin-4-one (CID 107485031) is 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-9-methylpyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-9-methylpyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-9-methylpyrido[1,2-a]pyrimidin-4-one is Cc1cccn2c(=O)cc(CN(CCO)CC(F)F)nc12.
What is the InChIKey of 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-9-methylpyrido[1,2-a]pyrimidin-4-one?
The InChIKey is VHNZGSJDALGRNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2N3O2/c1-10-3-2-4-19-13(21)7-11(17-14(10)19)8-18(5-6-20)9-12(15)16/h2-4,7,12,20H,5-6,8-9H2,1H3.
What are the key properties of 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-9-methylpyrido[1,2-a]pyrimidin-4-one?
2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-9-methylpyrido[1,2-a]pyrimidin-4-one has a molecular weight of 297.31 g/mol, XLogP of 1.06, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-9-methylpyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 107485031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).