About 2-[2,2-difluoroethyl(1,2-oxazol-5-ylmethyl)amino]ethanol
2-[2,2-difluoroethyl(1,2-oxazol-5-ylmethyl)amino]ethanol (PubChem CID 107485264) has the molecular formula C8H12F2N2O2
and a molecular weight of 206.19 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl(1,2-oxazol-5-ylmethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[2,2-difluoroethyl(1,2-oxazol-5-ylmethyl)amino]ethanol |
| PubChem CID | 107485264 |
| Molecular Formula | C8H12F2N2O2 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-[2,2-difluoroethyl(1,2-oxazol-5-ylmethyl)amino]ethanol |
| SMILES | OCCN(Cc1ccno1)CC(F)F |
| InChI | InChI=1S/C8H12F2N2O2/c9-8(10)6-12(3-4-13)5-7-1-2-11-14-7/h1-2,8,13H,3-6H2 |
| InChIKey | CQEAGKCYURXEAV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2,2-difluoroethyl(1,2-oxazol-5-ylmethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-difluoroethyl(1,2-oxazol-5-ylmethyl)amino]ethanol?
The IUPAC name of 2-[2,2-difluoroethyl(1,2-oxazol-5-ylmethyl)amino]ethanol (CID 107485264) is 2-[2,2-difluoroethyl(1,2-oxazol-5-ylmethyl)amino]ethanol.
What is the SMILES notation for 2-[2,2-difluoroethyl(1,2-oxazol-5-ylmethyl)amino]ethanol?
The canonical SMILES for 2-[2,2-difluoroethyl(1,2-oxazol-5-ylmethyl)amino]ethanol is OCCN(Cc1ccno1)CC(F)F.
What is the InChIKey of 2-[2,2-difluoroethyl(1,2-oxazol-5-ylmethyl)amino]ethanol?
The InChIKey is CQEAGKCYURXEAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2N2O2/c9-8(10)6-12(3-4-13)5-7-1-2-11-14-7/h1-2,8,13H,3-6H2.
What are the key properties of 2-[2,2-difluoroethyl(1,2-oxazol-5-ylmethyl)amino]ethanol?
2-[2,2-difluoroethyl(1,2-oxazol-5-ylmethyl)amino]ethanol has a molecular weight of 206.19 g/mol, XLogP of 0.73, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-difluoroethyl(1,2-oxazol-5-ylmethyl)amino]ethanol is sourced from PubChem (CID 107485264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).