About 2-[2,2-difluoroethyl-(3,5-dimethylcyclohexyl)amino]ethanol
2-[2,2-difluoroethyl-(3,5-dimethylcyclohexyl)amino]ethanol (PubChem CID 107485654) has the molecular formula C12H23F2NO
and a molecular weight of 235.32 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-(3,5-dimethylcyclohexyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[2,2-difluoroethyl-(3,5-dimethylcyclohexyl)amino]ethanol |
| PubChem CID | 107485654 |
| Molecular Formula | C12H23F2NO |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 2-[2,2-difluoroethyl-(3,5-dimethylcyclohexyl)amino]ethanol |
| SMILES | CC1CC(C)CC(N(CCO)CC(F)F)C1 |
| InChI | InChI=1S/C12H23F2NO/c1-9-5-10(2)7-11(6-9)15(3-4-16)8-12(13)14/h9-12,16H,3-8H2,1-2H3 |
| InChIKey | AKSWSEXWCFGWAO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2,2-difluoroethyl-(3,5-dimethylcyclohexyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-difluoroethyl-(3,5-dimethylcyclohexyl)amino]ethanol?
The IUPAC name of 2-[2,2-difluoroethyl-(3,5-dimethylcyclohexyl)amino]ethanol (CID 107485654) is 2-[2,2-difluoroethyl-(3,5-dimethylcyclohexyl)amino]ethanol.
What is the SMILES notation for 2-[2,2-difluoroethyl-(3,5-dimethylcyclohexyl)amino]ethanol?
The canonical SMILES for 2-[2,2-difluoroethyl-(3,5-dimethylcyclohexyl)amino]ethanol is CC1CC(C)CC(N(CCO)CC(F)F)C1.
What is the InChIKey of 2-[2,2-difluoroethyl-(3,5-dimethylcyclohexyl)amino]ethanol?
The InChIKey is AKSWSEXWCFGWAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23F2NO/c1-9-5-10(2)7-11(6-9)15(3-4-16)8-12(13)14/h9-12,16H,3-8H2,1-2H3.
What are the key properties of 2-[2,2-difluoroethyl-(3,5-dimethylcyclohexyl)amino]ethanol?
2-[2,2-difluoroethyl-(3,5-dimethylcyclohexyl)amino]ethanol has a molecular weight of 235.32 g/mol, XLogP of 2.37, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-difluoroethyl-(3,5-dimethylcyclohexyl)amino]ethanol is sourced from PubChem (CID 107485654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).