About 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2,2-difluoroethyl)amino]ethanol
2-[(2-amino-1,3-thiazol-5-yl)methyl-(2,2-difluoroethyl)amino]ethanol (PubChem CID 107486229) has the molecular formula C8H13F2N3OS
and a molecular weight of 237.27 g/mol. Its IUPAC name is 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2,2-difluoroethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2,2-difluoroethyl)amino]ethanol |
| PubChem CID | 107486229 |
| Molecular Formula | C8H13F2N3OS |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2,2-difluoroethyl)amino]ethanol |
| SMILES | Nc1ncc(CN(CCO)CC(F)F)s1 |
| InChI | InChI=1S/C8H13F2N3OS/c9-7(10)5-13(1-2-14)4-6-3-12-8(11)15-6/h3,7,14H,1-2,4-5H2,(H2,11,12) |
| InChIKey | GDUOTNCLRZIJBZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2,2-difluoroethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2,2-difluoroethyl)amino]ethanol?
The IUPAC name of 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2,2-difluoroethyl)amino]ethanol (CID 107486229) is 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2,2-difluoroethyl)amino]ethanol.
What is the SMILES notation for 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2,2-difluoroethyl)amino]ethanol?
The canonical SMILES for 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2,2-difluoroethyl)amino]ethanol is Nc1ncc(CN(CCO)CC(F)F)s1.
What is the InChIKey of 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2,2-difluoroethyl)amino]ethanol?
The InChIKey is GDUOTNCLRZIJBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2N3OS/c9-7(10)5-13(1-2-14)4-6-3-12-8(11)15-6/h3,7,14H,1-2,4-5H2,(H2,11,12).
What are the key properties of 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2,2-difluoroethyl)amino]ethanol?
2-[(2-amino-1,3-thiazol-5-yl)methyl-(2,2-difluoroethyl)amino]ethanol has a molecular weight of 237.27 g/mol, XLogP of 0.78, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-amino-1,3-thiazol-5-yl)methyl-(2,2-difluoroethyl)amino]ethanol is sourced from PubChem (CID 107486229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).