About 3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxan-4-one
3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxan-4-one (PubChem CID 107486402) has the molecular formula C10H17F2NO3
and a molecular weight of 237.25 g/mol. Its IUPAC name is 3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxan-4-one.
Molecular Properties
| Compound Name | 3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxan-4-one |
| PubChem CID | 107486402 |
| Molecular Formula | C10H17F2NO3 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxan-4-one |
| SMILES | O=C1CCOCC1CN(CCO)CC(F)F |
| InChI | InChI=1S/C10H17F2NO3/c11-10(12)6-13(2-3-14)5-8-7-16-4-1-9(8)15/h8,10,14H,1-7H2 |
| InChIKey | LHPPZLYSKFQLKW-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxan-4-one?
The IUPAC name of 3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxan-4-one (CID 107486402) is 3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxan-4-one.
What is the SMILES notation for 3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxan-4-one?
The canonical SMILES for 3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxan-4-one is O=C1CCOCC1CN(CCO)CC(F)F.
What is the InChIKey of 3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxan-4-one?
The InChIKey is LHPPZLYSKFQLKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NO3/c11-10(12)6-13(2-3-14)5-8-7-16-4-1-9(8)15/h8,10,14H,1-7H2.
What are the key properties of 3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxan-4-one?
3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxan-4-one has a molecular weight of 237.25 g/mol, XLogP of 0.15, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxan-4-one is sourced from PubChem (CID 107486402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).