About 2-[2,2-difluoroethyl-[2-methyl-2-(propylaminomethyl)pentyl]amino]ethanol
2-[2,2-difluoroethyl-[2-methyl-2-(propylaminomethyl)pentyl]amino]ethanol (PubChem CID 107486621) has the molecular formula C14H30F2N2O
and a molecular weight of 280.40 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-[2-methyl-2-(propylaminomethyl)pentyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[2,2-difluoroethyl-[2-methyl-2-(propylaminomethyl)pentyl]amino]ethanol |
| PubChem CID | 107486621 |
| Molecular Formula | C14H30F2N2O |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 2-[2,2-difluoroethyl-[2-methyl-2-(propylaminomethyl)pentyl]amino]ethanol |
| SMILES | CCCNCC(C)(CCC)CN(CCO)CC(F)F |
| InChI | InChI=1S/C14H30F2N2O/c1-4-6-14(3,11-17-7-5-2)12-18(8-9-19)10-13(15)16/h13,17,19H,4-12H2,1-3H3 |
| InChIKey | UZENVKLQVQTMFT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-difluoroethyl-[2-methyl-2-(propylaminomethyl)pentyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-difluoroethyl-[2-methyl-2-(propylaminomethyl)pentyl]amino]ethanol?
The IUPAC name of 2-[2,2-difluoroethyl-[2-methyl-2-(propylaminomethyl)pentyl]amino]ethanol (CID 107486621) is 2-[2,2-difluoroethyl-[2-methyl-2-(propylaminomethyl)pentyl]amino]ethanol.
What is the SMILES notation for 2-[2,2-difluoroethyl-[2-methyl-2-(propylaminomethyl)pentyl]amino]ethanol?
The canonical SMILES for 2-[2,2-difluoroethyl-[2-methyl-2-(propylaminomethyl)pentyl]amino]ethanol is CCCNCC(C)(CCC)CN(CCO)CC(F)F.
What is the InChIKey of 2-[2,2-difluoroethyl-[2-methyl-2-(propylaminomethyl)pentyl]amino]ethanol?
The InChIKey is UZENVKLQVQTMFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30F2N2O/c1-4-6-14(3,11-17-7-5-2)12-18(8-9-19)10-13(15)16/h13,17,19H,4-12H2,1-3H3.
What are the key properties of 2-[2,2-difluoroethyl-[2-methyl-2-(propylaminomethyl)pentyl]amino]ethanol?
2-[2,2-difluoroethyl-[2-methyl-2-(propylaminomethyl)pentyl]amino]ethanol has a molecular weight of 280.40 g/mol, XLogP of 2.35, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-difluoroethyl-[2-methyl-2-(propylaminomethyl)pentyl]amino]ethanol is sourced from PubChem (CID 107486621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).