C11H17F3N2O — CID 107486694
4,4,4-trifluoro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]butanamide (PubChem CID 107486694) has the molecular formula C11H17F3N2O and a molecular weight of 250.26 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 107486694 |
| Molecular Formula | C11H17F3N2O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 4,4,4-trifluoro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]butanamide |
| SMILES | O=C(CCC(F)(F)F)NCCC1=CCNCC1 |
| InChI | InChI=1S/C11H17F3N2O/c12-11(13,14)5-1-10(17)16-8-4-9-2-6-15-7-3-9/h2,15H,1,3-8H2,(H,16,17) |
| InChIKey | ANCYUCUONBCCJZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|