About 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cycloheptan-1-ol
2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cycloheptan-1-ol (PubChem CID 107487173) has the molecular formula C12H23F2NO2
and a molecular weight of 251.32 g/mol. Its IUPAC name is 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cycloheptan-1-ol.
Molecular Properties
| Compound Name | 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cycloheptan-1-ol |
| PubChem CID | 107487173 |
| Molecular Formula | C12H23F2NO2 |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cycloheptan-1-ol |
| SMILES | OCCN(CC(F)F)CC1CCCCCC1O |
| InChI | InChI=1S/C12H23F2NO2/c13-12(14)9-15(6-7-16)8-10-4-2-1-3-5-11(10)17/h10-12,16-17H,1-9H2 |
| InChIKey | RUZPNAOODTXKSU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cycloheptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cycloheptan-1-ol?
The IUPAC name of 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cycloheptan-1-ol (CID 107487173) is 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cycloheptan-1-ol.
What is the SMILES notation for 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cycloheptan-1-ol?
The canonical SMILES for 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cycloheptan-1-ol is OCCN(CC(F)F)CC1CCCCCC1O.
What is the InChIKey of 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cycloheptan-1-ol?
The InChIKey is RUZPNAOODTXKSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23F2NO2/c13-12(14)9-15(6-7-16)8-10-4-2-1-3-5-11(10)17/h10-12,16-17H,1-9H2.
What are the key properties of 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cycloheptan-1-ol?
2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cycloheptan-1-ol has a molecular weight of 251.32 g/mol, XLogP of 1.49, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cycloheptan-1-ol is sourced from PubChem (CID 107487173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).