C10H15BrF2N2S — CID 107487546
N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2,2-difluoroethanamine (PubChem CID 107487546) has the molecular formula C10H15BrF2N2S and a molecular weight of 313.21 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2,2-difluoroethanamine.
| Compound Name | N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 107487546 |
| Molecular Formula | C10H15BrF2N2S |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | N-(2-bromoethyl)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2,2-difluoroethanamine |
| SMILES | Cc1nc(CN(CCBr)CC(F)F)sc1C |
| InChI | InChI=1S/C10H15BrF2N2S/c1-7-8(2)16-10(14-7)6-15(4-3-11)5-9(12)13/h9H,3-6H2,1-2H3 |
| InChIKey | YXJLPMJWNNKNMG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|