C13H25N3O2S — CID 107487793
N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]azepane-1-sulfonamide (PubChem CID 107487793) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]azepane-1-sulfonamide.
| Compound Name | N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]azepane-1-sulfonamide |
|---|---|
| PubChem CID | 107487793 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]azepane-1-sulfonamide |
| SMILES | O=S(=O)(NCCC1=CCNCC1)N1CCCCCC1 |
| InChI | InChI=1S/C13H25N3O2S/c17-19(18,16-11-3-1-2-4-12-16)15-10-7-13-5-8-14-9-6-13/h5,14-15H,1-4,6-12H2 |
| InChIKey | GWAJLHDCTYSWAL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|