C8H14F2N2O2S — CID 107487817
1,1-difluoro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]methanesulfonamide (PubChem CID 107487817) has the molecular formula C8H14F2N2O2S and a molecular weight of 240.27 g/mol. Its IUPAC name is 1,1-difluoro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]methanesulfonamide.
| Compound Name | 1,1-difluoro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 107487817 |
| Molecular Formula | C8H14F2N2O2S |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1,1-difluoro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]methanesulfonamide |
| SMILES | O=S(=O)(NCCC1=CCNCC1)C(F)F |
| InChI | InChI=1S/C8H14F2N2O2S/c9-8(10)15(13,14)12-6-3-7-1-4-11-5-2-7/h1,8,11-12H,2-6H2 |
| InChIKey | VGWCPOIQNPUCBR-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|