About N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpentan-1-amine
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpentan-1-amine (PubChem CID 107487836) has the molecular formula C10H20ClF2N
and a molecular weight of 227.73 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpentan-1-amine.
Molecular Properties
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpentan-1-amine |
| PubChem CID | 107487836 |
| Molecular Formula | C10H20ClF2N |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpentan-1-amine |
| SMILES | CC(C)CCCN(CCCl)CC(F)F |
| InChI | InChI=1S/C10H20ClF2N/c1-9(2)4-3-6-14(7-5-11)8-10(12)13/h9-10H,3-8H2,1-2H3 |
| InChIKey | RPSJBLZTLWTSLB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpentan-1-amine?
The IUPAC name of N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpentan-1-amine (CID 107487836) is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpentan-1-amine.
What is the SMILES notation for N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpentan-1-amine?
The canonical SMILES for N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpentan-1-amine is CC(C)CCCN(CCCl)CC(F)F.
What is the InChIKey of N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpentan-1-amine?
The InChIKey is RPSJBLZTLWTSLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20ClF2N/c1-9(2)4-3-6-14(7-5-11)8-10(12)13/h9-10H,3-8H2,1-2H3.
What are the key properties of N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpentan-1-amine?
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpentan-1-amine has a molecular weight of 227.73 g/mol, XLogP of 3.23, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methylpentan-1-amine is sourced from PubChem (CID 107487836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).