C11H21N3O4S — CID 107487947
propan-2-yl N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylsulfamoyl]carbamate (PubChem CID 107487947) has the molecular formula C11H21N3O4S and a molecular weight of 291.37 g/mol. Its IUPAC name is propan-2-yl N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylsulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 107487947 |
| Molecular Formula | C11H21N3O4S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | propan-2-yl N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylsulfamoyl]carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)NCCC1=CCNCC1 |
| InChI | InChI=1S/C11H21N3O4S/c1-9(2)18-11(15)14-19(16,17)13-8-5-10-3-6-12-7-4-10/h3,9,12-13H,4-8H2,1-2H3,(H,14,15) |
| InChIKey | AJNXZULBAJECKW-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|