C10H19N3O4S — CID 107488083
ethyl N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylsulfamoyl]carbamate (PubChem CID 107488083) has the molecular formula C10H19N3O4S and a molecular weight of 277.35 g/mol. Its IUPAC name is ethyl N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylsulfamoyl]carbamate.
| Compound Name | ethyl N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 107488083 |
| Molecular Formula | C10H19N3O4S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | ethyl N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylsulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)NCCC1=CCNCC1 |
| InChI | InChI=1S/C10H19N3O4S/c1-2-17-10(14)13-18(15,16)12-8-5-9-3-6-11-7-4-9/h3,11-12H,2,4-8H2,1H3,(H,13,14) |
| InChIKey | QAVKHJPDOUPUML-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|