C17H21N3O — CID 107488396
7-methoxy-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]isoquinolin-1-amine (PubChem CID 107488396) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 7-methoxy-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]isoquinolin-1-amine.
| Compound Name | 7-methoxy-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]isoquinolin-1-amine |
|---|---|
| PubChem CID | 107488396 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 7-methoxy-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]isoquinolin-1-amine |
| SMILES | COc1ccc2ccnc(NCCC3=CCNCC3)c2c1 |
| InChI | InChI=1S/C17H21N3O/c1-21-15-3-2-14-7-11-20-17(16(14)12-15)19-10-6-13-4-8-18-9-5-13/h2-4,7,11-12,18H,5-6,8-10H2,1H3,(H,19,20) |
| InChIKey | JEXYKFKXYRFUIB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|