C11H16N4 — CID 107488480
6-N-tert-butyl-1H-indazole-5,6-diamine (PubChem CID 107488480) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 6-N-tert-butyl-1H-indazole-5,6-diamine.
| Compound Name | 6-N-tert-butyl-1H-indazole-5,6-diamine |
|---|---|
| PubChem CID | 107488480 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 6-N-tert-butyl-1H-indazole-5,6-diamine |
| SMILES | CC(C)(C)Nc1cc2[nH]ncc2cc1N |
| InChI | InChI=1S/C11H16N4/c1-11(2,3)14-10-5-9-7(4-8(10)12)6-13-15-9/h4-6,14H,12H2,1-3H3,(H,13,15) |
| InChIKey | CKIRXOYJTFVKJE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|