C11H11BrCl2F3N — CID 107488497
N-(2-bromoethyl)-N-[(2,5-dichlorophenyl)methyl]-2,2,2-trifluoroethanamine (PubChem CID 107488497) has the molecular formula C11H11BrCl2F3N and a molecular weight of 365.02 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(2,5-dichlorophenyl)methyl]-2,2,2-trifluoroethanamine.
| Compound Name | N-(2-bromoethyl)-N-[(2,5-dichlorophenyl)methyl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 107488497 |
| Molecular Formula | C11H11BrCl2F3N |
| Molecular Weight | 365.02 g/mol |
| Exact Mass | 362.94 |
| IUPAC Name | N-(2-bromoethyl)-N-[(2,5-dichlorophenyl)methyl]-2,2,2-trifluoroethanamine |
| SMILES | FC(F)(F)CN(CCBr)Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H11BrCl2F3N/c12-3-4-18(7-11(15,16)17)6-8-5-9(13)1-2-10(8)14/h1-2,5H,3-4,6-7H2 |
| InChIKey | MFBAYPAOMHFBTQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.02 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|