C10H17BrF3NO — CID 107488561
N-(2-bromoethyl)-2,2,2-trifluoro-N-[2-(oxolan-2-yl)ethyl]ethanamine (PubChem CID 107488561) has the molecular formula C10H17BrF3NO and a molecular weight of 304.15 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,2,2-trifluoro-N-[2-(oxolan-2-yl)ethyl]ethanamine.
| Compound Name | N-(2-bromoethyl)-2,2,2-trifluoro-N-[2-(oxolan-2-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 107488561 |
| Molecular Formula | C10H17BrF3NO |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | N-(2-bromoethyl)-2,2,2-trifluoro-N-[2-(oxolan-2-yl)ethyl]ethanamine |
| SMILES | FC(F)(F)CN(CCBr)CCC1CCCO1 |
| InChI | InChI=1S/C10H17BrF3NO/c11-4-6-15(8-10(12,13)14)5-3-9-2-1-7-16-9/h9H,1-8H2 |
| InChIKey | HPHDINRFMDEZPO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|