C12H18Br2F3N3 — CID 107488607
N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-N-(2-bromoethyl)-2,2,2-trifluoroethanamine (PubChem CID 107488607) has the molecular formula C12H18Br2F3N3 and a molecular weight of 421.10 g/mol. Its IUPAC name is N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-N-(2-bromoethyl)-2,2,2-trifluoroethanamine.
| Compound Name | N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-N-(2-bromoethyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 107488607 |
| Molecular Formula | C12H18Br2F3N3 |
| Molecular Weight | 421.10 g/mol |
| Exact Mass | 418.98 |
| IUPAC Name | N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-N-(2-bromoethyl)-2,2,2-trifluoroethanamine |
| SMILES | CCc1nn(CC)c(CN(CCBr)CC(F)(F)F)c1Br |
| InChI | InChI=1S/C12H18Br2F3N3/c1-3-9-11(14)10(20(4-2)18-9)7-19(6-5-13)8-12(15,16)17/h3-8H2,1-2H3 |
| InChIKey | GYKCPPZSCWHAEG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.10 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|