C14H14BrF3N2 — CID 107488634
N-(2-bromoethyl)-2,2,2-trifluoro-N-(quinolin-2-ylmethyl)ethanamine (PubChem CID 107488634) has the molecular formula C14H14BrF3N2 and a molecular weight of 347.18 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,2,2-trifluoro-N-(quinolin-2-ylmethyl)ethanamine.
| Compound Name | N-(2-bromoethyl)-2,2,2-trifluoro-N-(quinolin-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 107488634 |
| Molecular Formula | C14H14BrF3N2 |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | N-(2-bromoethyl)-2,2,2-trifluoro-N-(quinolin-2-ylmethyl)ethanamine |
| SMILES | FC(F)(F)CN(CCBr)Cc1ccc2ccccc2n1 |
| InChI | InChI=1S/C14H14BrF3N2/c15-7-8-20(10-14(16,17)18)9-12-6-5-11-3-1-2-4-13(11)19-12/h1-6H,7-10H2 |
| InChIKey | MTYNEUUWUDZFSF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|