C11H19ClF3NO — CID 107488740
N-(2-chloroethyl)-3-(oxolan-2-yl)-N-(2,2,2-trifluoroethyl)propan-1-amine (PubChem CID 107488740) has the molecular formula C11H19ClF3NO and a molecular weight of 273.73 g/mol. Its IUPAC name is N-(2-chloroethyl)-3-(oxolan-2-yl)-N-(2,2,2-trifluoroethyl)propan-1-amine.
| Compound Name | N-(2-chloroethyl)-3-(oxolan-2-yl)-N-(2,2,2-trifluoroethyl)propan-1-amine |
|---|---|
| PubChem CID | 107488740 |
| Molecular Formula | C11H19ClF3NO |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-(2-chloroethyl)-3-(oxolan-2-yl)-N-(2,2,2-trifluoroethyl)propan-1-amine |
| SMILES | FC(F)(F)CN(CCCl)CCCC1CCCO1 |
| InChI | InChI=1S/C11H19ClF3NO/c12-5-7-16(9-11(13,14)15)6-1-3-10-4-2-8-17-10/h10H,1-9H2 |
| InChIKey | URAZJWNYRVCQBN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|