C11H15N7 — CID 107489227
N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]tetrazolo[1,5-a]pyrazin-5-amine (PubChem CID 107489227) has the molecular formula C11H15N7 and a molecular weight of 245.29 g/mol. Its IUPAC name is N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]tetrazolo[1,5-a]pyrazin-5-amine.
| Compound Name | N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]tetrazolo[1,5-a]pyrazin-5-amine |
|---|---|
| PubChem CID | 107489227 |
| Molecular Formula | C11H15N7 |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]tetrazolo[1,5-a]pyrazin-5-amine |
| SMILES | C1=C(CCNc2cncc3nnnn23)CCNC1 |
| InChI | InChI=1S/C11H15N7/c1-4-12-5-2-9(1)3-6-14-10-7-13-8-11-15-16-17-18(10)11/h1,7-8,12,14H,2-6H2 |
| InChIKey | ZNODCYHCJYHTKS-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 80.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|