C15H18N4 — CID 107489358
N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]cinnolin-4-amine (PubChem CID 107489358) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]cinnolin-4-amine.
| Compound Name | N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]cinnolin-4-amine |
|---|---|
| PubChem CID | 107489358 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]cinnolin-4-amine |
| SMILES | C1=C(CCNc2cnnc3ccccc23)CCNC1 |
| InChI | InChI=1S/C15H18N4/c1-2-4-14-13(3-1)15(11-18-19-14)17-10-7-12-5-8-16-9-6-12/h1-5,11,16H,6-10H2,(H,17,19) |
| InChIKey | MCZSUABOZWXBKG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|