C17H18N4 — CID 107489421
4-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]quinoline-3-carbonitrile (PubChem CID 107489421) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]quinoline-3-carbonitrile.
| Compound Name | 4-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 107489421 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 4-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2ccccc2c1NCCC1=CCNCC1 |
| InChI | InChI=1S/C17H18N4/c18-11-14-12-21-16-4-2-1-3-15(16)17(14)20-10-7-13-5-8-19-9-6-13/h1-5,12,19H,6-10H2,(H,20,21) |
| InChIKey | SNLONEBBOSDZHG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|