C13H16IN3O2 — CID 107489470
4-iodo-2-nitro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]aniline (PubChem CID 107489470) has the molecular formula C13H16IN3O2 and a molecular weight of 373.19 g/mol. Its IUPAC name is 4-iodo-2-nitro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]aniline.
| Compound Name | 4-iodo-2-nitro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]aniline |
|---|---|
| PubChem CID | 107489470 |
| Molecular Formula | C13H16IN3O2 |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 4-iodo-2-nitro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]aniline |
| SMILES | O=[N+]([O-])c1cc(I)ccc1NCCC1=CCNCC1 |
| InChI | InChI=1S/C13H16IN3O2/c14-11-1-2-12(13(9-11)17(18)19)16-8-5-10-3-6-15-7-4-10/h1-3,9,15-16H,4-8H2 |
| InChIKey | WXQLEHSAMCYVIV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|