About N-(2-bromoethyl)-N-(2,2-difluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 107489637) has the molecular formula C11H14BrF2N3
and a molecular weight of 306.15 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| PubChem CID | 107489637 |
| Molecular Formula | C11H14BrF2N3 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | FC(F)CN(CCBr)c1ncnc2c1CCC2 |
| InChI | InChI=1S/C11H14BrF2N3/c12-4-5-17(6-10(13)14)11-8-2-1-3-9(8)15-7-16-11/h7,10H,1-6H2 |
| InChIKey | VHLSENRTLPYKCG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromoethyl)-N-(2,2-difluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromoethyl)-N-(2,2-difluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The IUPAC name of N-(2-bromoethyl)-N-(2,2-difluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (CID 107489637) is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
What is the SMILES notation for N-(2-bromoethyl)-N-(2,2-difluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The canonical SMILES for N-(2-bromoethyl)-N-(2,2-difluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine is FC(F)CN(CCBr)c1ncnc2c1CCC2.
What is the InChIKey of N-(2-bromoethyl)-N-(2,2-difluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The InChIKey is VHLSENRTLPYKCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrF2N3/c12-4-5-17(6-10(13)14)11-8-2-1-3-9(8)15-7-16-11/h7,10H,1-6H2.
What are the key properties of N-(2-bromoethyl)-N-(2,2-difluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine has a molecular weight of 306.15 g/mol, XLogP of 2.43, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromoethyl)-N-(2,2-difluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine is sourced from PubChem (CID 107489637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).