C9H10BrF2N5O — CID 107489715
7-[2-bromoethyl(2,2-difluoroethyl)amino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 107489715) has the molecular formula C9H10BrF2N5O and a molecular weight of 322.11 g/mol. Its IUPAC name is 7-[2-bromoethyl(2,2-difluoroethyl)amino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 7-[2-bromoethyl(2,2-difluoroethyl)amino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 107489715 |
| Molecular Formula | C9H10BrF2N5O |
| Molecular Weight | 322.11 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 7-[2-bromoethyl(2,2-difluoroethyl)amino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | O=c1[nH]nc2cc(N(CCBr)CC(F)F)ncn12 |
| InChI | InChI=1S/C9H10BrF2N5O/c10-1-2-16(4-6(11)12)7-3-8-14-15-9(18)17(8)5-13-7/h3,5-6H,1-2,4H2,(H,15,18) |
| InChIKey | XHFFRBHMLVEXTR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.11 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|