C8H9ClF2N6 — CID 107489756
N-(2-chloroethyl)-N-(2,2-difluoroethyl)tetrazolo[1,5-a]pyrazin-5-amine (PubChem CID 107489756) has the molecular formula C8H9ClF2N6 and a molecular weight of 262.65 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)tetrazolo[1,5-a]pyrazin-5-amine.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)tetrazolo[1,5-a]pyrazin-5-amine |
|---|---|
| PubChem CID | 107489756 |
| Molecular Formula | C8H9ClF2N6 |
| Molecular Weight | 262.65 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)tetrazolo[1,5-a]pyrazin-5-amine |
| SMILES | FC(F)CN(CCCl)c1cncc2nnnn12 |
| InChI | InChI=1S/C8H9ClF2N6/c9-1-2-16(5-6(10)11)8-4-12-3-7-13-14-15-17(7)8/h3-4,6H,1-2,5H2 |
| InChIKey | AEIFQZMVMXYBRI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 59.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.65 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|