About N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methyl-1,3-thiazol-2-amine
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methyl-1,3-thiazol-2-amine (PubChem CID 107489976) has the molecular formula C8H11ClF2N2S
and a molecular weight of 240.71 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methyl-1,3-thiazol-2-amine |
| PubChem CID | 107489976 |
| Molecular Formula | C8H11ClF2N2S |
| Molecular Weight | 240.71 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(N(CCCl)CC(F)F)n1 |
| InChI | InChI=1S/C8H11ClF2N2S/c1-6-5-14-8(12-6)13(3-2-9)4-7(10)11/h5,7H,2-4H2,1H3 |
| InChIKey | GXMMABCLBABNET-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.71 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methyl-1,3-thiazol-2-amine?
The IUPAC name of N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methyl-1,3-thiazol-2-amine (CID 107489976) is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methyl-1,3-thiazol-2-amine.
What is the SMILES notation for N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methyl-1,3-thiazol-2-amine?
The canonical SMILES for N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methyl-1,3-thiazol-2-amine is Cc1csc(N(CCCl)CC(F)F)n1.
What is the InChIKey of N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methyl-1,3-thiazol-2-amine?
The InChIKey is GXMMABCLBABNET-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClF2N2S/c1-6-5-14-8(12-6)13(3-2-9)4-7(10)11/h5,7H,2-4H2,1H3.
What are the key properties of N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methyl-1,3-thiazol-2-amine?
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methyl-1,3-thiazol-2-amine has a molecular weight of 240.71 g/mol, XLogP of 2.76, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloroethyl)-N-(2,2-difluoroethyl)-4-methyl-1,3-thiazol-2-amine is sourced from PubChem (CID 107489976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).