C11H11ClF2N4O2 — CID 107489987
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-6-nitro-1H-benzimidazol-2-amine (PubChem CID 107489987) has the molecular formula C11H11ClF2N4O2 and a molecular weight of 304.68 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-6-nitro-1H-benzimidazol-2-amine.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-6-nitro-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 107489987 |
| Molecular Formula | C11H11ClF2N4O2 |
| Molecular Weight | 304.68 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-6-nitro-1H-benzimidazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc2nc(N(CCCl)CC(F)F)[nH]c2c1 |
| InChI | InChI=1S/C11H11ClF2N4O2/c12-3-4-17(6-10(13)14)11-15-8-2-1-7(18(19)20)5-9(8)16-11/h1-2,5,10H,3-4,6H2,(H,15,16) |
| InChIKey | DSQZYJHPUVVXFN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.68 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|