C7H10ClF2N3S — CID 107490143
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-3-methyl-1,2,4-thiadiazol-5-amine (PubChem CID 107490143) has the molecular formula C7H10ClF2N3S and a molecular weight of 241.69 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-3-methyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-3-methyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 107490143 |
| Molecular Formula | C7H10ClF2N3S |
| Molecular Weight | 241.69 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-3-methyl-1,2,4-thiadiazol-5-amine |
| SMILES | Cc1nsc(N(CCCl)CC(F)F)n1 |
| InChI | InChI=1S/C7H10ClF2N3S/c1-5-11-7(14-12-5)13(3-2-8)4-6(9)10/h6H,2-4H2,1H3 |
| InChIKey | RITNBQKADJDZSQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.69 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|