C10H12ClF2N5O — CID 107490145
7-[2-chloroethyl(2,2-difluoroethyl)amino]-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 107490145) has the molecular formula C10H12ClF2N5O and a molecular weight of 291.69 g/mol. Its IUPAC name is 7-[2-chloroethyl(2,2-difluoroethyl)amino]-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 7-[2-chloroethyl(2,2-difluoroethyl)amino]-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 107490145 |
| Molecular Formula | C10H12ClF2N5O |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 7-[2-chloroethyl(2,2-difluoroethyl)amino]-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | Cc1nc(N(CCCl)CC(F)F)cc2n[nH]c(=O)n12 |
| InChI | InChI=1S/C10H12ClF2N5O/c1-6-14-8(17(3-2-11)5-7(12)13)4-9-15-16-10(19)18(6)9/h4,7H,2-3,5H2,1H3,(H,16,19) |
| InChIKey | HPWSPXPRTHMVEO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|