C9H9BrF3N5O — CID 107490191
6-[2-bromoethyl(2,2,2-trifluoroethyl)amino]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 107490191) has the molecular formula C9H9BrF3N5O and a molecular weight of 340.10 g/mol. Its IUPAC name is 6-[2-bromoethyl(2,2,2-trifluoroethyl)amino]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-[2-bromoethyl(2,2,2-trifluoroethyl)amino]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 107490191 |
| Molecular Formula | C9H9BrF3N5O |
| Molecular Weight | 340.10 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 6-[2-bromoethyl(2,2,2-trifluoroethyl)amino]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | O=c1[nH]nc2ccc(N(CCBr)CC(F)(F)F)nn12 |
| InChI | InChI=1S/C9H9BrF3N5O/c10-3-4-17(5-9(11,12)13)7-2-1-6-14-15-8(19)18(6)16-7/h1-2H,3-5H2,(H,15,19) |
| InChIKey | JEDQZEPYDQTRRZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.10 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|