C14H22N6 — CID 107490314
6-N-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-indazole-5,6-diamine (PubChem CID 107490314) has the molecular formula C14H22N6 and a molecular weight of 274.37 g/mol. Its IUPAC name is 6-N-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-indazole-5,6-diamine.
| Compound Name | 6-N-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-indazole-5,6-diamine |
|---|---|
| PubChem CID | 107490314 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 6-N-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-indazole-5,6-diamine |
| SMILES | CN1CCN(C)C(CNc2cc3[nH]ncc3cc2N)C1 |
| InChI | InChI=1S/C14H22N6/c1-19-3-4-20(2)11(9-19)8-16-14-6-13-10(5-12(14)15)7-17-18-13/h5-7,11,16H,3-4,8-9,15H2,1-2H3,(H,17,18) |
| InChIKey | LZMNPZAJZHAJTN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|