C12H17ClF3N3O — CID 107490700
N-(2-chloroethyl)-4-methyl-6-propoxy-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine (PubChem CID 107490700) has the molecular formula C12H17ClF3N3O and a molecular weight of 311.74 g/mol. Its IUPAC name is N-(2-chloroethyl)-4-methyl-6-propoxy-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine.
| Compound Name | N-(2-chloroethyl)-4-methyl-6-propoxy-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 107490700 |
| Molecular Formula | C12H17ClF3N3O |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-(2-chloroethyl)-4-methyl-6-propoxy-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine |
| SMILES | CCCOc1cc(C)nc(N(CCCl)CC(F)(F)F)n1 |
| InChI | InChI=1S/C12H17ClF3N3O/c1-3-6-20-10-7-9(2)17-11(18-10)19(5-4-13)8-12(14,15)16/h7H,3-6,8H2,1-2H3 |
| InChIKey | KCGLLZJHLBERFO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|