C11H16ClF3N4 — CID 107490704
N-(2-chloroethyl)-5,6-diethyl-N-(2,2,2-trifluoroethyl)-1,2,4-triazin-3-amine (PubChem CID 107490704) has the molecular formula C11H16ClF3N4 and a molecular weight of 296.72 g/mol. Its IUPAC name is N-(2-chloroethyl)-5,6-diethyl-N-(2,2,2-trifluoroethyl)-1,2,4-triazin-3-amine.
| Compound Name | N-(2-chloroethyl)-5,6-diethyl-N-(2,2,2-trifluoroethyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 107490704 |
| Molecular Formula | C11H16ClF3N4 |
| Molecular Weight | 296.72 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-(2-chloroethyl)-5,6-diethyl-N-(2,2,2-trifluoroethyl)-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(N(CCCl)CC(F)(F)F)nc1CC |
| InChI | InChI=1S/C11H16ClF3N4/c1-3-8-9(4-2)17-18-10(16-8)19(6-5-12)7-11(13,14)15/h3-7H2,1-2H3 |
| InChIKey | LHCYFEIRYMAVCV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.72 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|